C31H36N4O4S3 — CID 4700993
5-[[3-[3-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-3-hexyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4700993) has the molecular formula C31H36N4O4S3 and a molecular weight of 624.85 g/mol. Its IUPAC name is 5-[[3-[3-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-3-hexyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[3-[3-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-3-hexyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4700993 |
| Molecular Formula | C31H36N4O4S3 |
| Molecular Weight | 624.85 g/mol |
| Exact Mass | 624.19 |
| IUPAC Name | 5-[[3-[3-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-3-hexyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCCCN1C(=O)C(=Cc2cn(-c3ccccc3)nc2-c2cccc(S(=O)(=O)N3CC(C)OC(C)C3)c2)SC1=S |
| InChI | InChI=1S/C31H36N4O4S3/c1-4-5-6-10-16-34-30(36)28(41-31(34)40)18-25-21-35(26-13-8-7-9-14-26)32-29(25)24-12-11-15-27(17-24)42(37,38)33-19-22(2)39-23(3)20-33/h7-9,11-15,17-18,21-23H,4-6,10,16,19-20H2,1-3H3 |
| InChIKey | ZHYUONSWGFWNIV-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.85 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|