C35H34N4O5S3 — CID 4700938
ethyl 1-[3-[4-[[4-oxo-3-(1-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 4700938) has the molecular formula C35H34N4O5S3 and a molecular weight of 686.88 g/mol. Its IUPAC name is ethyl 1-[3-[4-[[4-oxo-3-(1-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-[4-[[4-oxo-3-(1-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 4700938 |
| Molecular Formula | C35H34N4O5S3 |
| Molecular Weight | 686.88 g/mol |
| Exact Mass | 686.17 |
| IUPAC Name | ethyl 1-[3-[4-[[4-oxo-3-(1-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(S(=O)(=O)c2cccc(-c3nn(-c4ccccc4)cc3C=C3SC(=S)N(C(C)c4ccccc4)C3=O)c2)CC1 |
| InChI | InChI=1S/C35H34N4O5S3/c1-3-44-34(41)26-17-19-37(20-18-26)47(42,43)30-16-10-13-27(21-30)32-28(23-38(36-32)29-14-8-5-9-15-29)22-31-33(40)39(35(45)46-31)24(2)25-11-6-4-7-12-25/h4-16,21-24,26H,3,17-20H2,1-2H3 |
| InChIKey | UUEWENOUSRISRH-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 101.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.88 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|