C31H35N5O4S2 — CID 18806677
(5Z)-5-[[3-[3-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-(3-methylpiperidin-1-yl)-1,3-thiazol-4-one (PubChem CID 18806677) has the molecular formula C31H35N5O4S2 and a molecular weight of 605.79 g/mol. Its IUPAC name is (5Z)-5-[[3-[3-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-(3-methylpiperidin-1-yl)-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[[3-[3-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-(3-methylpiperidin-1-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 18806677 |
| Molecular Formula | C31H35N5O4S2 |
| Molecular Weight | 605.79 g/mol |
| Exact Mass | 605.21 |
| IUPAC Name | (5Z)-5-[[3-[3-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-(3-methylpiperidin-1-yl)-1,3-thiazol-4-one |
| SMILES | CC1CCCN(C2=NC(=O)/C(=C/c3cn(-c4ccccc4)nc3-c3cccc(S(=O)(=O)N4CC(C)OC(C)C4)c3)S2)C1 |
| InChI | InChI=1S/C31H35N5O4S2/c1-21-9-8-14-34(17-21)31-32-30(37)28(41-31)16-25-20-36(26-11-5-4-6-12-26)33-29(25)24-10-7-13-27(15-24)42(38,39)35-18-22(2)40-23(3)19-35/h4-7,10-13,15-16,20-23H,8-9,14,17-19H2,1-3H3/b28-16- |
| InChIKey | XCVQRMFEEYJQLV-NTFVMDSBSA-N |
| XLogP | 5.04 |
| TPSA | 97.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.79 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|