C29H31N5O4S2 — CID 4700605
2-(3-methylpiperidin-1-yl)-5-[[3-(3-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one (PubChem CID 4700605) has the molecular formula C29H31N5O4S2 and a molecular weight of 577.73 g/mol. Its IUPAC name is 2-(3-methylpiperidin-1-yl)-5-[[3-(3-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one.
| Compound Name | 2-(3-methylpiperidin-1-yl)-5-[[3-(3-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 4700605 |
| Molecular Formula | C29H31N5O4S2 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.18 |
| IUPAC Name | 2-(3-methylpiperidin-1-yl)-5-[[3-(3-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one |
| SMILES | CC1CCCN(C2=NC(=O)C(=Cc3cn(-c4ccccc4)nc3-c3cccc(S(=O)(=O)N4CCOCC4)c3)S2)C1 |
| InChI | InChI=1S/C29H31N5O4S2/c1-21-7-6-12-32(19-21)29-30-28(35)26(39-29)18-23-20-34(24-9-3-2-4-10-24)31-27(23)22-8-5-11-25(17-22)40(36,37)33-13-15-38-16-14-33/h2-5,8-11,17-18,20-21H,6-7,12-16,19H2,1H3 |
| InChIKey | MSAZPIHYDCJUQY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 97.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|