C38H41N5O3S2 — CID 4701103
2-(4-benzylpiperidin-1-yl)-5-[[3-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one (PubChem CID 4701103) has the molecular formula C38H41N5O3S2 and a molecular weight of 679.91 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-[[3-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-[[3-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 4701103 |
| Molecular Formula | C38H41N5O3S2 |
| Molecular Weight | 679.91 g/mol |
| Exact Mass | 679.27 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-[[3-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2cccc(-c3nn(-c4ccccc4)cc3C=C3SC(N4CCC(Cc5ccccc5)CC4)=NC3=O)c2)C1 |
| InChI | InChI=1S/C38H41N5O3S2/c1-27-20-28(2)25-42(24-27)48(45,46)34-15-9-12-31(22-34)36-32(26-43(40-36)33-13-7-4-8-14-33)23-35-37(44)39-38(47-35)41-18-16-30(17-19-41)21-29-10-5-3-6-11-29/h3-15,22-23,26-28,30H,16-21,24-25H2,1-2H3 |
| InChIKey | MNTPMSZLSLROHC-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 87.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.91 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|