C31H35N5O3S2 — CID 4701102
5-[[3-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-piperidin-1-yl-1,3-thiazol-4-one (PubChem CID 4701102) has the molecular formula C31H35N5O3S2 and a molecular weight of 589.79 g/mol. Its IUPAC name is 5-[[3-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-piperidin-1-yl-1,3-thiazol-4-one.
| Compound Name | 5-[[3-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-piperidin-1-yl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 4701102 |
| Molecular Formula | C31H35N5O3S2 |
| Molecular Weight | 589.79 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | 5-[[3-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-piperidin-1-yl-1,3-thiazol-4-one |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2cccc(-c3nn(-c4ccccc4)cc3C=C3SC(N4CCCCC4)=NC3=O)c2)C1 |
| InChI | InChI=1S/C31H35N5O3S2/c1-22-16-23(2)20-35(19-22)41(38,39)27-13-9-10-24(17-27)29-25(21-36(33-29)26-11-5-3-6-12-26)18-28-30(37)32-31(40-28)34-14-7-4-8-15-34/h3,5-6,9-13,17-18,21-23H,4,7-8,14-16,19-20H2,1-2H3 |
| InChIKey | KKQRMLOONFSHGG-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 87.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.79 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|