C29H33N5O5S2 — CID 45126882
acetic acid;N,N-dimethyl-3-[4-[(Z)-[2-(3-methylpiperidin-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-1-phenylpyrazol-3-yl]benzenesulfonamide (PubChem CID 45126882) has the molecular formula C29H33N5O5S2 and a molecular weight of 595.75 g/mol. Its IUPAC name is acetic acid;N,N-dimethyl-3-[4-[(Z)-[2-(3-methylpiperidin-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-1-phenylpyrazol-3-yl]benzenesulfonamide.
| Compound Name | acetic acid;N,N-dimethyl-3-[4-[(Z)-[2-(3-methylpiperidin-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-1-phenylpyrazol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 45126882 |
| Molecular Formula | C29H33N5O5S2 |
| Molecular Weight | 595.75 g/mol |
| Exact Mass | 595.19 |
| IUPAC Name | acetic acid;N,N-dimethyl-3-[4-[(Z)-[2-(3-methylpiperidin-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-1-phenylpyrazol-3-yl]benzenesulfonamide |
| SMILES | CC(=O)O.CC1CCCN(C2=NC(=O)/C(=C/c3cn(-c4ccccc4)nc3-c3cccc(S(=O)(=O)N(C)C)c3)S2)C1 |
| InChI | InChI=1S/C27H29N5O3S2.C2H4O2/c1-19-9-8-14-31(17-19)27-28-26(33)24(36-27)16-21-18-32(22-11-5-4-6-12-22)29-25(21)20-10-7-13-23(15-20)37(34,35)30(2)3;1-2(3)4/h4-7,10-13,15-16,18-19H,8-9,14,17H2,1-3H3;1H3,(H,3,4)/b24-16-; |
| InChIKey | YTTFRMHWCLKOFV-PNNXLEGYSA-N |
| XLogP | 4.58 |
| TPSA | 125.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.75 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|