C27H29N5O4S2 — CID 4277040
4-[4-[[2-(2,6-dimethylmorpholin-4-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-1-phenylpyrazol-3-yl]-N,N-dimethylbenzenesulfonamide (PubChem CID 4277040) has the molecular formula C27H29N5O4S2 and a molecular weight of 551.69 g/mol. Its IUPAC name is 4-[4-[[2-(2,6-dimethylmorpholin-4-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-1-phenylpyrazol-3-yl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[4-[[2-(2,6-dimethylmorpholin-4-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-1-phenylpyrazol-3-yl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 4277040 |
| Molecular Formula | C27H29N5O4S2 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | 4-[4-[[2-(2,6-dimethylmorpholin-4-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-1-phenylpyrazol-3-yl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CC1CN(C2=NC(=O)C(=Cc3cn(-c4ccccc4)nc3-c3ccc(S(=O)(=O)N(C)C)cc3)S2)CC(C)O1 |
| InChI | InChI=1S/C27H29N5O4S2/c1-18-15-31(16-19(2)36-18)27-28-26(33)24(37-27)14-21-17-32(22-8-6-5-7-9-22)29-25(21)20-10-12-23(13-11-20)38(34,35)30(3)4/h5-14,17-19H,15-16H2,1-4H3 |
| InChIKey | VCVLUHHNFKQZQR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 97.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|