C29H32N4O2S2 — CID 6579735
(5Z)-5-[[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1,3-thiazol-4-one (PubChem CID 6579735) has the molecular formula C29H32N4O2S2 and a molecular weight of 532.74 g/mol. Its IUPAC name is (5Z)-5-[[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 6579735 |
| Molecular Formula | C29H32N4O2S2 |
| Molecular Weight | 532.74 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | (5Z)-5-[[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1,3-thiazol-4-one |
| SMILES | CCCCSc1ccc(-c2nn(-c3ccccc3)cc2/C=C2\SC(N3C[C@@H](C)O[C@@H](C)C3)=NC2=O)cc1 |
| InChI | InChI=1S/C29H32N4O2S2/c1-4-5-15-36-25-13-11-22(12-14-25)27-23(19-33(31-27)24-9-7-6-8-10-24)16-26-28(34)30-29(37-26)32-17-20(2)35-21(3)18-32/h6-14,16,19-21H,4-5,15,17-18H2,1-3H3/b26-16-/t20-,21+ |
| InChIKey | UAKUXDBXZAFKIO-GNUDVLMQSA-N |
| XLogP | 6.51 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.74 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|