C33H32N4O3S — CID 4700050
2-(2,6-dimethylmorpholin-4-yl)-5-[[3-[3-[(4-methylphenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one (PubChem CID 4700050) has the molecular formula C33H32N4O3S and a molecular weight of 564.71 g/mol. Its IUPAC name is 2-(2,6-dimethylmorpholin-4-yl)-5-[[3-[3-[(4-methylphenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one.
| Compound Name | 2-(2,6-dimethylmorpholin-4-yl)-5-[[3-[3-[(4-methylphenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 4700050 |
| Molecular Formula | C33H32N4O3S |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | 2-(2,6-dimethylmorpholin-4-yl)-5-[[3-[3-[(4-methylphenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one |
| SMILES | Cc1ccc(COc2cccc(-c3nn(-c4ccccc4)cc3C=C3SC(N4CC(C)OC(C)C4)=NC3=O)c2)cc1 |
| InChI | InChI=1S/C33H32N4O3S/c1-22-12-14-25(15-13-22)21-39-29-11-7-8-26(16-29)31-27(20-37(35-31)28-9-5-4-6-10-28)17-30-32(38)34-33(41-30)36-18-23(2)40-24(3)19-36/h4-17,20,23-24H,18-19,21H2,1-3H3 |
| InChIKey | MRKBUWYJXOPHDR-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 68.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|