C25H23FN4O2S — CID 34307551
(5Z)-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-[[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one (PubChem CID 34307551) has the molecular formula C25H23FN4O2S and a molecular weight of 462.55 g/mol. Its IUPAC name is (5Z)-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-[[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-[[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 34307551 |
| Molecular Formula | C25H23FN4O2S |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | (5Z)-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-[[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one |
| SMILES | C[C@@H]1CN(C2=NC(=O)/C(=C/c3cn(-c4ccccc4)nc3-c3ccc(F)cc3)S2)C[C@@H](C)O1 |
| InChI | InChI=1S/C25H23FN4O2S/c1-16-13-29(14-17(2)32-16)25-27-24(31)22(33-25)12-19-15-30(21-6-4-3-5-7-21)28-23(19)18-8-10-20(26)11-9-18/h3-12,15-17H,13-14H2,1-2H3/b22-12-/t16-,17-/m1/s1 |
| InChIKey | QHQORVMTQKBEOZ-MPRKLJSHSA-N |
| XLogP | 4.76 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|