C31H34N4O3S2 — CID 4699756
ethyl 1-[5-[[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate (PubChem CID 4699756) has the molecular formula C31H34N4O3S2 and a molecular weight of 574.77 g/mol. Its IUPAC name is ethyl 1-[5-[[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[5-[[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 4699756 |
| Molecular Formula | C31H34N4O3S2 |
| Molecular Weight | 574.77 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | ethyl 1-[5-[[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate |
| SMILES | CCCCSc1ccc(-c2nn(-c3ccccc3)cc2C=C2SC(N3CCC(C(=O)OCC)CC3)=NC2=O)cc1 |
| InChI | InChI=1S/C31H34N4O3S2/c1-3-5-19-39-26-13-11-22(12-14-26)28-24(21-35(33-28)25-9-7-6-8-10-25)20-27-29(36)32-31(40-27)34-17-15-23(16-18-34)30(37)38-4-2/h6-14,20-21,23H,3-5,15-19H2,1-2H3 |
| InChIKey | HJHUBSQFYMPOBF-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 76.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.77 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|