C29H32N4O2S — CID 4700267
5-[[3-(3-butoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-(4-methylpiperidin-1-yl)-1,3-thiazol-4-one (PubChem CID 4700267) has the molecular formula C29H32N4O2S and a molecular weight of 500.67 g/mol. Its IUPAC name is 5-[[3-(3-butoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-(4-methylpiperidin-1-yl)-1,3-thiazol-4-one.
| Compound Name | 5-[[3-(3-butoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-(4-methylpiperidin-1-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 4700267 |
| Molecular Formula | C29H32N4O2S |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 5-[[3-(3-butoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-(4-methylpiperidin-1-yl)-1,3-thiazol-4-one |
| SMILES | CCCCOc1cccc(-c2nn(-c3ccccc3)cc2C=C2SC(N3CCC(C)CC3)=NC2=O)c1 |
| InChI | InChI=1S/C29H32N4O2S/c1-3-4-17-35-25-12-8-9-22(18-25)27-23(20-33(31-27)24-10-6-5-7-11-24)19-26-28(34)30-29(36-26)32-15-13-21(2)14-16-32/h5-12,18-21H,3-4,13-17H2,1-2H3 |
| InChIKey | ATFVMHXVXKLOET-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|