C32H30N4O2S — CID 3806285
2-(4-benzylpiperidin-1-yl)-5-[[3-(3-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one (PubChem CID 3806285) has the molecular formula C32H30N4O2S and a molecular weight of 534.69 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-[[3-(3-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-[[3-(3-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 3806285 |
| Molecular Formula | C32H30N4O2S |
| Molecular Weight | 534.69 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-[[3-(3-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one |
| SMILES | COc1cccc(-c2nn(-c3ccccc3)cc2C=C2SC(N3CCC(Cc4ccccc4)CC3)=NC2=O)c1 |
| InChI | InChI=1S/C32H30N4O2S/c1-38-28-14-8-11-25(20-28)30-26(22-36(34-30)27-12-6-3-7-13-27)21-29-31(37)33-32(39-29)35-17-15-24(16-18-35)19-23-9-4-2-5-10-23/h2-14,20-22,24H,15-19H2,1H3 |
| InChIKey | GDWDVQXTYYJBAR-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.69 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|