C32H28ClN5O3S — CID 4699873
1-[5-[[3-[3-[(2-chlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxamide (PubChem CID 4699873) has the molecular formula C32H28ClN5O3S and a molecular weight of 598.13 g/mol. Its IUPAC name is 1-[5-[[3-[3-[(2-chlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-[5-[[3-[3-[(2-chlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 4699873 |
| Molecular Formula | C32H28ClN5O3S |
| Molecular Weight | 598.13 g/mol |
| Exact Mass | 597.16 |
| IUPAC Name | 1-[5-[[3-[3-[(2-chlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C2=NC(=O)C(=Cc3cn(-c4ccccc4)nc3-c3cccc(OCc4ccccc4Cl)c3)S2)CC1 |
| InChI | InChI=1S/C32H28ClN5O3S/c33-27-12-5-4-7-23(27)20-41-26-11-6-8-22(17-26)29-24(19-38(36-29)25-9-2-1-3-10-25)18-28-31(40)35-32(42-28)37-15-13-21(14-16-37)30(34)39/h1-12,17-19,21H,13-16,20H2,(H2,34,39) |
| InChIKey | XLJBQLZYTMROLJ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 102.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.13 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|