C34H31FN4O4S — CID 3291747
ethyl 1-[5-[[3-[4-[(2-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate (PubChem CID 3291747) has the molecular formula C34H31FN4O4S and a molecular weight of 610.71 g/mol. Its IUPAC name is ethyl 1-[5-[[3-[4-[(2-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[5-[[3-[4-[(2-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 3291747 |
| Molecular Formula | C34H31FN4O4S |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.21 |
| IUPAC Name | ethyl 1-[5-[[3-[4-[(2-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C2=NC(=O)C(=Cc3cn(-c4ccccc4)nc3-c3ccc(OCc4ccccc4F)cc3)S2)CC1 |
| InChI | InChI=1S/C34H31FN4O4S/c1-2-42-33(41)24-16-18-38(19-17-24)34-36-32(40)30(44-34)20-26-21-39(27-9-4-3-5-10-27)37-31(26)23-12-14-28(15-13-23)43-22-25-8-6-7-11-29(25)35/h3-15,20-21,24H,2,16-19,22H2,1H3 |
| InChIKey | HJCUXIDIZDSANB-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 86.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|