C31H34N6O4S2 — CID 4700794
1-[5-[[3-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxamide (PubChem CID 4700794) has the molecular formula C31H34N6O4S2 and a molecular weight of 618.79 g/mol. Its IUPAC name is 1-[5-[[3-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-[5-[[3-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 4700794 |
| Molecular Formula | C31H34N6O4S2 |
| Molecular Weight | 618.79 g/mol |
| Exact Mass | 618.21 |
| IUPAC Name | 1-[5-[[3-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxamide |
| SMILES | CC1CCN(S(=O)(=O)c2cccc(-c3nn(-c4ccccc4)cc3C=C3SC(N4CCC(C(N)=O)CC4)=NC3=O)c2)CC1 |
| InChI | InChI=1S/C31H34N6O4S2/c1-21-10-16-36(17-11-21)43(40,41)26-9-5-6-23(18-26)28-24(20-37(34-28)25-7-3-2-4-8-25)19-27-30(39)33-31(42-27)35-14-12-22(13-15-35)29(32)38/h2-9,18-22H,10-17H2,1H3,(H2,32,38) |
| InChIKey | YXOPWFPKRXWNSF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 130.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.79 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|