C24H23N5OS — CID 6314799
(5Z)-2-(4-methylpiperidin-1-yl)-5-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylidene]-1,3-thiazol-4-one (PubChem CID 6314799) has the molecular formula C24H23N5OS and a molecular weight of 429.55 g/mol. Its IUPAC name is (5Z)-2-(4-methylpiperidin-1-yl)-5-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-(4-methylpiperidin-1-yl)-5-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 6314799 |
| Molecular Formula | C24H23N5OS |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | (5Z)-2-(4-methylpiperidin-1-yl)-5-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylidene]-1,3-thiazol-4-one |
| SMILES | CC1CCN(C2=NC(=O)/C(=C/c3cn(-c4ccccc4)nc3-c3ccncc3)S2)CC1 |
| InChI | InChI=1S/C24H23N5OS/c1-17-9-13-28(14-10-17)24-26-23(30)21(31-24)15-19-16-29(20-5-3-2-4-6-20)27-22(19)18-7-11-25-12-8-18/h2-8,11-12,15-17H,9-10,13-14H2,1H3/b21-15- |
| InChIKey | RTUXFVZYKRGSKA-QNGOZBTKSA-N |
| XLogP | 4.64 |
| TPSA | 63.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|