C32H30N4O6S2 — CID 18806649
ethyl 1-[3-[4-[(Z)-2-(benzenesulfonyl)-2-cyanoethenyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 18806649) has the molecular formula C32H30N4O6S2 and a molecular weight of 630.75 g/mol. Its IUPAC name is ethyl 1-[3-[4-[(Z)-2-(benzenesulfonyl)-2-cyanoethenyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-[4-[(Z)-2-(benzenesulfonyl)-2-cyanoethenyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 18806649 |
| Molecular Formula | C32H30N4O6S2 |
| Molecular Weight | 630.75 g/mol |
| Exact Mass | 630.16 |
| IUPAC Name | ethyl 1-[3-[4-[(Z)-2-(benzenesulfonyl)-2-cyanoethenyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(S(=O)(=O)c2cccc(-c3nn(-c4ccccc4)cc3/C=C(/C#N)S(=O)(=O)c3ccccc3)c2)CC1 |
| InChI | InChI=1S/C32H30N4O6S2/c1-2-42-32(37)24-16-18-35(19-17-24)44(40,41)29-15-9-10-25(20-29)31-26(23-36(34-31)27-11-5-3-6-12-27)21-30(22-33)43(38,39)28-13-7-4-8-14-28/h3-15,20-21,23-24H,2,16-19H2,1H3/b30-21- |
| InChIKey | XCEXWZOLVAVXAF-OFWBYEQRSA-N |
| XLogP | 4.84 |
| TPSA | 139.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.75 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|