C32H32N4O4S2 — CID 18806703
(Z)-3-[3-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]-2-(4-methylphenyl)sulfonylprop-2-enenitrile (PubChem CID 18806703) has the molecular formula C32H32N4O4S2 and a molecular weight of 600.77 g/mol. Its IUPAC name is (Z)-3-[3-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]-2-(4-methylphenyl)sulfonylprop-2-enenitrile.
| Compound Name | (Z)-3-[3-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]-2-(4-methylphenyl)sulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 18806703 |
| Molecular Formula | C32H32N4O4S2 |
| Molecular Weight | 600.77 g/mol |
| Exact Mass | 600.19 |
| IUPAC Name | (Z)-3-[3-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]-2-(4-methylphenyl)sulfonylprop-2-enenitrile |
| SMILES | Cc1ccc(S(=O)(=O)/C(C#N)=C\c2cn(-c3ccccc3)nc2-c2cccc(S(=O)(=O)N3CC(C)CC(C)C3)c2)cc1 |
| InChI | InChI=1S/C32H32N4O4S2/c1-23-12-14-29(15-13-23)41(37,38)31(19-33)18-27-22-36(28-9-5-4-6-10-28)34-32(27)26-8-7-11-30(17-26)42(39,40)35-20-24(2)16-25(3)21-35/h4-15,17-18,22,24-25H,16,20-21H2,1-3H3/b31-18- |
| InChIKey | JFBOEZGFPHMHNX-MNBJERMJSA-N |
| XLogP | 5.85 |
| TPSA | 113.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.77 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|