C20H17N3O2S — CID 8828486
(E)-3-[3-(3-methylphenyl)-1-phenylpyrazol-4-yl]-2-methylsulfonylprop-2-enenitrile (PubChem CID 8828486) has the molecular formula C20H17N3O2S and a molecular weight of 363.44 g/mol. Its IUPAC name is (E)-3-[3-(3-methylphenyl)-1-phenylpyrazol-4-yl]-2-methylsulfonylprop-2-enenitrile.
| Compound Name | (E)-3-[3-(3-methylphenyl)-1-phenylpyrazol-4-yl]-2-methylsulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 8828486 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | (E)-3-[3-(3-methylphenyl)-1-phenylpyrazol-4-yl]-2-methylsulfonylprop-2-enenitrile |
| SMILES | Cc1cccc(-c2nn(-c3ccccc3)cc2/C=C(\C#N)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H17N3O2S/c1-15-7-6-8-16(11-15)20-17(12-19(13-21)26(2,24)25)14-23(22-20)18-9-4-3-5-10-18/h3-12,14H,1-2H3/b19-12+ |
| InChIKey | JCDRZJAMKZWPTM-XDHOZWIPSA-N |
| XLogP | 3.76 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|