C19H14N4O — CID 2688371
(Z)-2-cyano-3-(1,3-diphenylpyrazol-4-yl)prop-2-enamide (PubChem CID 2688371) has the molecular formula C19H14N4O and a molecular weight of 314.35 g/mol. Its IUPAC name is (Z)-2-cyano-3-(1,3-diphenylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(1,3-diphenylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 2688371 |
| Molecular Formula | C19H14N4O |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (Z)-2-cyano-3-(1,3-diphenylpyrazol-4-yl)prop-2-enamide |
| SMILES | N#C/C(=C/c1cn(-c2ccccc2)nc1-c1ccccc1)C(N)=O |
| InChI | InChI=1S/C19H14N4O/c20-12-15(19(21)24)11-16-13-23(17-9-5-2-6-10-17)22-18(16)14-7-3-1-4-8-14/h1-11,13H,(H2,21,24)/b15-11- |
| InChIKey | IONAMTQUYCMBFK-PTNGSMBKSA-N |
| XLogP | 2.93 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|