C23H16N6O — CID 5178043
2-amino-4-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]buta-1,3-diene-1,1,3-tricarbonitrile (PubChem CID 5178043) has the molecular formula C23H16N6O and a molecular weight of 392.42 g/mol. Its IUPAC name is 2-amino-4-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]buta-1,3-diene-1,1,3-tricarbonitrile.
| Compound Name | 2-amino-4-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]buta-1,3-diene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 5178043 |
| Molecular Formula | C23H16N6O |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2-amino-4-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]buta-1,3-diene-1,1,3-tricarbonitrile |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2C=C(C#N)C(N)=C(C#N)C#N)cc1 |
| InChI | InChI=1S/C23H16N6O/c1-30-21-9-7-16(8-10-21)23-18(11-17(12-24)22(27)19(13-25)14-26)15-29(28-23)20-5-3-2-4-6-20/h2-11,15H,27H2,1H3 |
| InChIKey | QEPQOBVGYCVAAG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|