C20H16N4OS — CID 2393024
(Z)-2-cyano-3-[3-(3-methoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enethioamide (PubChem CID 2393024) has the molecular formula C20H16N4OS and a molecular weight of 360.44 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3-(3-methoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enethioamide.
| Compound Name | (Z)-2-cyano-3-[3-(3-methoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enethioamide |
|---|---|
| PubChem CID | 2393024 |
| Molecular Formula | C20H16N4OS |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (Z)-2-cyano-3-[3-(3-methoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enethioamide |
| SMILES | COc1cccc(-c2nn(-c3ccccc3)cc2/C=C(/C#N)C(N)=S)c1 |
| InChI | InChI=1S/C20H16N4OS/c1-25-18-9-5-6-14(11-18)19-16(10-15(12-21)20(22)26)13-24(23-19)17-7-3-2-4-8-17/h2-11,13H,1H3,(H2,22,26)/b15-10- |
| InChIKey | IFAWMNHGEMECMA-GDNBJRDFSA-N |
| XLogP | 3.74 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|