C28H22FN3O3 — CID 18806133
ethyl (Z)-2-cyano-3-[3-[3-[(4-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]prop-2-enoate (PubChem CID 18806133) has the molecular formula C28H22FN3O3 and a molecular weight of 467.50 g/mol. Its IUPAC name is ethyl (Z)-2-cyano-3-[3-[3-[(4-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]prop-2-enoate.
| Compound Name | ethyl (Z)-2-cyano-3-[3-[3-[(4-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 18806133 |
| Molecular Formula | C28H22FN3O3 |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | ethyl (Z)-2-cyano-3-[3-[3-[(4-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C\c1cn(-c2ccccc2)nc1-c1cccc(OCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C28H22FN3O3/c1-2-34-28(33)22(17-30)15-23-18-32(25-8-4-3-5-9-25)31-27(23)21-7-6-10-26(16-21)35-19-20-11-13-24(29)14-12-20/h3-16,18H,2,19H2,1H3/b22-15- |
| InChIKey | TZYCIVJGIPCOOL-JCMHNJIXSA-N |
| XLogP | 5.73 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|