C23H20ClN3O3 — CID 4700462
ethyl 3-[3-(3-chloro-4-ethoxyphenyl)-1-phenylpyrazol-4-yl]-2-cyanoprop-2-enoate (PubChem CID 4700462) has the molecular formula C23H20ClN3O3 and a molecular weight of 421.88 g/mol. Its IUPAC name is ethyl 3-[3-(3-chloro-4-ethoxyphenyl)-1-phenylpyrazol-4-yl]-2-cyanoprop-2-enoate.
| Compound Name | ethyl 3-[3-(3-chloro-4-ethoxyphenyl)-1-phenylpyrazol-4-yl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 4700462 |
| Molecular Formula | C23H20ClN3O3 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | ethyl 3-[3-(3-chloro-4-ethoxyphenyl)-1-phenylpyrazol-4-yl]-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)C(C#N)=Cc1cn(-c2ccccc2)nc1-c1ccc(OCC)c(Cl)c1 |
| InChI | InChI=1S/C23H20ClN3O3/c1-3-29-21-11-10-16(13-20(21)24)22-18(12-17(14-25)23(28)30-4-2)15-27(26-22)19-8-6-5-7-9-19/h5-13,15H,3-4H2,1-2H3 |
| InChIKey | RSHGIJRDJJHHPF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|