C28H24N4O2 — CID 4700178
2-cyano-3-[3-(3-ethoxyphenyl)-1-phenylpyrazol-4-yl]-N-(4-methylphenyl)prop-2-enamide (PubChem CID 4700178) has the molecular formula C28H24N4O2 and a molecular weight of 448.53 g/mol. Its IUPAC name is 2-cyano-3-[3-(3-ethoxyphenyl)-1-phenylpyrazol-4-yl]-N-(4-methylphenyl)prop-2-enamide.
| Compound Name | 2-cyano-3-[3-(3-ethoxyphenyl)-1-phenylpyrazol-4-yl]-N-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4700178 |
| Molecular Formula | C28H24N4O2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 2-cyano-3-[3-(3-ethoxyphenyl)-1-phenylpyrazol-4-yl]-N-(4-methylphenyl)prop-2-enamide |
| SMILES | CCOc1cccc(-c2nn(-c3ccccc3)cc2C=C(C#N)C(=O)Nc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C28H24N4O2/c1-3-34-26-11-7-8-21(17-26)27-23(19-32(31-27)25-9-5-4-6-10-25)16-22(18-29)28(33)30-24-14-12-20(2)13-15-24/h4-17,19H,3H2,1-2H3,(H,30,33) |
| InChIKey | AVRYZPNOPIRTMK-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|