C28H25N5O3S — CID 18806526
(Z)-2-cyano-3-[3-[3-(dimethylsulfamoyl)phenyl]-1-phenylpyrazol-4-yl]-N-(4-methylphenyl)prop-2-enamide (PubChem CID 18806526) has the molecular formula C28H25N5O3S and a molecular weight of 511.61 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3-[3-(dimethylsulfamoyl)phenyl]-1-phenylpyrazol-4-yl]-N-(4-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3-[3-(dimethylsulfamoyl)phenyl]-1-phenylpyrazol-4-yl]-N-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 18806526 |
| Molecular Formula | C28H25N5O3S |
| Molecular Weight | 511.61 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | (Z)-2-cyano-3-[3-[3-(dimethylsulfamoyl)phenyl]-1-phenylpyrazol-4-yl]-N-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C(C#N)=C\c2cn(-c3ccccc3)nc2-c2cccc(S(=O)(=O)N(C)C)c2)cc1 |
| InChI | InChI=1S/C28H25N5O3S/c1-20-12-14-24(15-13-20)30-28(34)22(18-29)16-23-19-33(25-9-5-4-6-10-25)31-27(23)21-8-7-11-26(17-21)37(35,36)32(2)3/h4-17,19H,1-3H3,(H,30,34)/b22-16- |
| InChIKey | CFKRZAVEYZNZRU-JWGURIENSA-N |
| XLogP | 4.64 |
| TPSA | 108.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.61 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|