C24H22N4O4S — CID 3743650
2-cyano-N-(1,1-dioxothiolan-3-yl)-3-[3-(3-methoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enamide (PubChem CID 3743650) has the molecular formula C24H22N4O4S and a molecular weight of 462.53 g/mol. Its IUPAC name is 2-cyano-N-(1,1-dioxothiolan-3-yl)-3-[3-(3-methoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-(1,1-dioxothiolan-3-yl)-3-[3-(3-methoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3743650 |
| Molecular Formula | C24H22N4O4S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 2-cyano-N-(1,1-dioxothiolan-3-yl)-3-[3-(3-methoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enamide |
| SMILES | COc1cccc(-c2nn(-c3ccccc3)cc2C=C(C#N)C(=O)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C24H22N4O4S/c1-32-22-9-5-6-17(13-22)23-19(15-28(27-23)21-7-3-2-4-8-21)12-18(14-25)24(29)26-20-10-11-33(30,31)16-20/h2-9,12-13,15,20H,10-11,16H2,1H3,(H,26,29) |
| InChIKey | DHSTWPFQIOMFSB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 114.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|