C29H31N5O5S2 — CID 18806761
(Z)-2-cyano-N-(1,1-dioxothiolan-3-yl)-3-[3-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]prop-2-enamide (PubChem CID 18806761) has the molecular formula C29H31N5O5S2 and a molecular weight of 593.73 g/mol. Its IUPAC name is (Z)-2-cyano-N-(1,1-dioxothiolan-3-yl)-3-[3-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(1,1-dioxothiolan-3-yl)-3-[3-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 18806761 |
| Molecular Formula | C29H31N5O5S2 |
| Molecular Weight | 593.73 g/mol |
| Exact Mass | 593.18 |
| IUPAC Name | (Z)-2-cyano-N-(1,1-dioxothiolan-3-yl)-3-[3-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]prop-2-enamide |
| SMILES | CC1CCCN(S(=O)(=O)c2cccc(-c3nn(-c4ccccc4)cc3/C=C(/C#N)C(=O)NC3CCS(=O)(=O)C3)c2)C1 |
| InChI | InChI=1S/C29H31N5O5S2/c1-21-7-6-13-33(18-21)41(38,39)27-11-5-8-22(16-27)28-24(19-34(32-28)26-9-3-2-4-10-26)15-23(17-30)29(35)31-25-12-14-40(36,37)20-25/h2-5,8-11,15-16,19,21,25H,6-7,12-14,18,20H2,1H3,(H,31,35)/b23-15- |
| InChIKey | MDCMNYYFZCHANK-HAHDFKILSA-N |
| XLogP | 3.17 |
| TPSA | 142.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.73 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|