C29H31N5O3S — CID 18806551
(Z)-2-cyano-N-cyclohexyl-3-[1-phenyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)pyrazol-4-yl]prop-2-enamide (PubChem CID 18806551) has the molecular formula C29H31N5O3S and a molecular weight of 529.67 g/mol. Its IUPAC name is (Z)-2-cyano-N-cyclohexyl-3-[1-phenyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)pyrazol-4-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-cyclohexyl-3-[1-phenyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)pyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 18806551 |
| Molecular Formula | C29H31N5O3S |
| Molecular Weight | 529.67 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | (Z)-2-cyano-N-cyclohexyl-3-[1-phenyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)pyrazol-4-yl]prop-2-enamide |
| SMILES | N#C/C(=C/c1cn(-c2ccccc2)nc1-c1cccc(S(=O)(=O)N2CCCC2)c1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C29H31N5O3S/c30-20-23(29(35)31-25-11-3-1-4-12-25)18-24-21-34(26-13-5-2-6-14-26)32-28(24)22-10-9-15-27(19-22)38(36,37)33-16-7-8-17-33/h2,5-6,9-10,13-15,18-19,21,25H,1,3-4,7-8,11-12,16-17H2,(H,31,35)/b23-18- |
| InChIKey | CQCBRMZTWAXJIT-NKFKGCMQSA-N |
| XLogP | 4.68 |
| TPSA | 108.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.67 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|