C32H30N6O2S — CID 4701216
2-(1-methylbenzimidazol-2-yl)-3-[3-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]prop-2-enenitrile (PubChem CID 4701216) has the molecular formula C32H30N6O2S and a molecular weight of 562.70 g/mol. Its IUPAC name is 2-(1-methylbenzimidazol-2-yl)-3-[3-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]prop-2-enenitrile.
| Compound Name | 2-(1-methylbenzimidazol-2-yl)-3-[3-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 4701216 |
| Molecular Formula | C32H30N6O2S |
| Molecular Weight | 562.70 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | 2-(1-methylbenzimidazol-2-yl)-3-[3-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]prop-2-enenitrile |
| SMILES | CC1CCCN(S(=O)(=O)c2cccc(-c3nn(-c4ccccc4)cc3C=C(C#N)c3nc4ccccc4n3C)c2)C1 |
| InChI | InChI=1S/C32H30N6O2S/c1-23-10-9-17-37(21-23)41(39,40)28-14-8-11-24(19-28)31-26(22-38(35-31)27-12-4-3-5-13-27)18-25(20-33)32-34-29-15-6-7-16-30(29)36(32)2/h3-8,11-16,18-19,22-23H,9-10,17,21H2,1-2H3 |
| InChIKey | YOBOVAWPFVWLGS-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 96.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.70 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|