C26H19N5 — CID 7912313
(E)-3-(1,3-diphenylpyrazol-4-yl)-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile (PubChem CID 7912313) has the molecular formula C26H19N5 and a molecular weight of 401.47 g/mol. Its IUPAC name is (E)-3-(1,3-diphenylpyrazol-4-yl)-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(1,3-diphenylpyrazol-4-yl)-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 7912313 |
| Molecular Formula | C26H19N5 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | (E)-3-(1,3-diphenylpyrazol-4-yl)-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile |
| SMILES | Cn1c(/C(C#N)=C/c2cn(-c3ccccc3)nc2-c2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C26H19N5/c1-30-24-15-9-8-14-23(24)28-26(30)20(17-27)16-21-18-31(22-12-6-3-7-13-22)29-25(21)19-10-4-2-5-11-19/h2-16,18H,1H3/b20-16+ |
| InChIKey | KGIVKOMFIBXVHJ-CAPFRKAQSA-N |
| XLogP | 5.49 |
| TPSA | 59.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|