C25H18N6 — CID 93049670
(Z)-2-(1-methylbenzimidazol-2-yl)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enenitrile (PubChem CID 93049670) has the molecular formula C25H18N6 and a molecular weight of 402.46 g/mol. Its IUPAC name is (Z)-2-(1-methylbenzimidazol-2-yl)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enenitrile.
| Compound Name | (Z)-2-(1-methylbenzimidazol-2-yl)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 93049670 |
| Molecular Formula | C25H18N6 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | (Z)-2-(1-methylbenzimidazol-2-yl)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enenitrile |
| SMILES | Cn1c(/C(C#N)=C\c2cn(-c3ccccc3)nc2-c2cccnc2)nc2ccccc21 |
| InChI | InChI=1S/C25H18N6/c1-30-23-12-6-5-11-22(23)28-25(30)19(15-26)14-20-17-31(21-9-3-2-4-10-21)29-24(20)18-8-7-13-27-16-18/h2-14,16-17H,1H3/b19-14- |
| InChIKey | GXEFDLRPABGGRY-RGEXLXHISA-N |
| XLogP | 4.89 |
| TPSA | 72.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|