C26H18N4O — CID 171919271
3-(1,3-diphenylpyrazol-4-yl)-2-(5-methyl-1,3-benzoxazol-2-yl)prop-2-enenitrile (PubChem CID 171919271) has the molecular formula C26H18N4O and a molecular weight of 402.46 g/mol. Its IUPAC name is 3-(1,3-diphenylpyrazol-4-yl)-2-(5-methyl-1,3-benzoxazol-2-yl)prop-2-enenitrile.
| Compound Name | 3-(1,3-diphenylpyrazol-4-yl)-2-(5-methyl-1,3-benzoxazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 171919271 |
| Molecular Formula | C26H18N4O |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 3-(1,3-diphenylpyrazol-4-yl)-2-(5-methyl-1,3-benzoxazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1ccc2oc(C(C#N)=Cc3cn(-c4ccccc4)nc3-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C26H18N4O/c1-18-12-13-24-23(14-18)28-26(31-24)20(16-27)15-21-17-30(22-10-6-3-7-11-22)29-25(21)19-8-4-2-5-9-19/h2-15,17H,1H3 |
| InChIKey | OUSNHVPGFMFXNN-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 67.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|