C19H15N3O2S — CID 8828373
(E)-3-(1,3-diphenylpyrazol-4-yl)-2-methylsulfonylprop-2-enenitrile (PubChem CID 8828373) has the molecular formula C19H15N3O2S and a molecular weight of 349.42 g/mol. Its IUPAC name is (E)-3-(1,3-diphenylpyrazol-4-yl)-2-methylsulfonylprop-2-enenitrile.
| Compound Name | (E)-3-(1,3-diphenylpyrazol-4-yl)-2-methylsulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 8828373 |
| Molecular Formula | C19H15N3O2S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | (E)-3-(1,3-diphenylpyrazol-4-yl)-2-methylsulfonylprop-2-enenitrile |
| SMILES | CS(=O)(=O)/C(C#N)=C/c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C19H15N3O2S/c1-25(23,24)18(13-20)12-16-14-22(17-10-6-3-7-11-17)21-19(16)15-8-4-2-5-9-15/h2-12,14H,1H3/b18-12+ |
| InChIKey | CHLUEWIUWZERHQ-LDADJPATSA-N |
| XLogP | 3.45 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|