C19H12N3O2- — CID 2345073
(E)-2-cyano-3-(1,3-diphenylpyrazol-4-yl)prop-2-enoate (PubChem CID 2345073) has the molecular formula C19H12N3O2- and a molecular weight of 314.32 g/mol. Its IUPAC name is (E)-2-cyano-3-(1,3-diphenylpyrazol-4-yl)prop-2-enoate.
| Compound Name | (E)-2-cyano-3-(1,3-diphenylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 2345073 |
| Molecular Formula | C19H12N3O2- |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | (E)-2-cyano-3-(1,3-diphenylpyrazol-4-yl)prop-2-enoate |
| SMILES | N#C/C(=C\c1cn(-c2ccccc2)nc1-c1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C19H13N3O2/c20-12-15(19(23)24)11-16-13-22(17-9-5-2-6-10-17)21-18(16)14-7-3-1-4-8-14/h1-11,13H,(H,23,24)/p-1/b15-11+ |
| InChIKey | GHHHLGXZLLIGQN-RVDMUPIBSA-M |
| XLogP | 2.20 |
| TPSA | 81.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|