C19H11BrN3O2- — CID 2345559
(Z)-3-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]-2-cyanoprop-2-enoate (PubChem CID 2345559) has the molecular formula C19H11BrN3O2- and a molecular weight of 393.22 g/mol. Its IUPAC name is (Z)-3-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]-2-cyanoprop-2-enoate.
| Compound Name | (Z)-3-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 2345559 |
| Molecular Formula | C19H11BrN3O2- |
| Molecular Weight | 393.22 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | (Z)-3-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]-2-cyanoprop-2-enoate |
| SMILES | N#C/C(=C/c1cn(-c2ccccc2)nc1-c1ccc(Br)cc1)C(=O)[O-] |
| InChI | InChI=1S/C19H12BrN3O2/c20-16-8-6-13(7-9-16)18-15(10-14(11-21)19(24)25)12-23(22-18)17-4-2-1-3-5-17/h1-10,12H,(H,24,25)/p-1/b14-10- |
| InChIKey | BXZGTYMCKZVNLC-UVTDQMKNSA-M |
| XLogP | 2.96 |
| TPSA | 81.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.22 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|