C23H19BrN4O3S — CID 34259160
(E)-3-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-[(3R)-1,1-dioxothiolan-3-yl]prop-2-enamide (PubChem CID 34259160) has the molecular formula C23H19BrN4O3S and a molecular weight of 511.40 g/mol. Its IUPAC name is (E)-3-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-[(3R)-1,1-dioxothiolan-3-yl]prop-2-enamide.
| Compound Name | (E)-3-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-[(3R)-1,1-dioxothiolan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 34259160 |
| Molecular Formula | C23H19BrN4O3S |
| Molecular Weight | 511.40 g/mol |
| Exact Mass | 510.04 |
| IUPAC Name | (E)-3-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-[(3R)-1,1-dioxothiolan-3-yl]prop-2-enamide |
| SMILES | N#C/C(=C\c1cn(-c2ccccc2)nc1-c1ccc(Br)cc1)C(=O)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C23H19BrN4O3S/c24-19-8-6-16(7-9-19)22-18(14-28(27-22)21-4-2-1-3-5-21)12-17(13-25)23(29)26-20-10-11-32(30,31)15-20/h1-9,12,14,20H,10-11,15H2,(H,26,29)/b17-12+/t20-/m1/s1 |
| InChIKey | RPLCUHORCSFTBG-KEWOFRHOSA-N |
| XLogP | 3.51 |
| TPSA | 104.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|