C21H20BrN5O2S2 — CID 34257634
1-[(Z)-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-[(3S)-1,1-dioxothiolan-3-yl]thiourea (PubChem CID 34257634) has the molecular formula C21H20BrN5O2S2 and a molecular weight of 518.46 g/mol. Its IUPAC name is 1-[(Z)-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-[(3S)-1,1-dioxothiolan-3-yl]thiourea.
| Compound Name | 1-[(Z)-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-[(3S)-1,1-dioxothiolan-3-yl]thiourea |
|---|---|
| PubChem CID | 34257634 |
| Molecular Formula | C21H20BrN5O2S2 |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 517.02 |
| IUPAC Name | 1-[(Z)-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-[(3S)-1,1-dioxothiolan-3-yl]thiourea |
| SMILES | O=S1(=O)CC[C@H](NC(=S)N/N=C\c2cn(-c3ccccc3)nc2-c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C21H20BrN5O2S2/c22-17-8-6-15(7-9-17)20-16(13-27(26-20)19-4-2-1-3-5-19)12-23-25-21(30)24-18-10-11-31(28,29)14-18/h1-9,12-13,18H,10-11,14H2,(H2,24,25,30)/b23-12-/t18-/m0/s1 |
| InChIKey | JKTNQNIHCRETMT-NVIPHDJISA-N |
| XLogP | 3.29 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|