C25H20BrN5O2 — CID 3519058
N'-[[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-N-(3-methylphenyl)oxamide (PubChem CID 3519058) has the molecular formula C25H20BrN5O2 and a molecular weight of 502.37 g/mol. Its IUPAC name is N'-[[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-N-(3-methylphenyl)oxamide.
| Compound Name | N'-[[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-N-(3-methylphenyl)oxamide |
|---|---|
| PubChem CID | 3519058 |
| Molecular Formula | C25H20BrN5O2 |
| Molecular Weight | 502.37 g/mol |
| Exact Mass | 501.08 |
| IUPAC Name | N'-[[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-N-(3-methylphenyl)oxamide |
| SMILES | Cc1cccc(NC(=O)C(=O)NN=Cc2cn(-c3ccccc3)nc2-c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C25H20BrN5O2/c1-17-6-5-7-21(14-17)28-24(32)25(33)29-27-15-19-16-31(22-8-3-2-4-9-22)30-23(19)18-10-12-20(26)13-11-18/h2-16H,1H3,(H,28,32)(H,29,33) |
| InChIKey | MTGZSNPEPAQILN-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|