C32H27N5O3 — CID 6179064
N-(3-methylphenyl)-N'-[(Z)-[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]oxamide (PubChem CID 6179064) has the molecular formula C32H27N5O3 and a molecular weight of 529.60 g/mol. Its IUPAC name is N-(3-methylphenyl)-N'-[(Z)-[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]oxamide.
| Compound Name | N-(3-methylphenyl)-N'-[(Z)-[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 6179064 |
| Molecular Formula | C32H27N5O3 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | N-(3-methylphenyl)-N'-[(Z)-[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]oxamide |
| SMILES | Cc1cccc(NC(=O)C(=O)N/N=C\c2cn(-c3ccccc3)nc2-c2ccc(OCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C32H27N5O3/c1-23-9-8-12-27(19-23)34-31(38)32(39)35-33-20-26-21-37(28-13-6-3-7-14-28)36-30(26)25-15-17-29(18-16-25)40-22-24-10-4-2-5-11-24/h2-21H,22H2,1H3,(H,34,38)(H,35,39)/b33-20- |
| InChIKey | RUNMVNSKCSCZSI-UCMJSZAQSA-N |
| XLogP | 5.52 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|