C32H28N4O3 — CID 51061653
N-[(E)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-[(4-methylphenyl)methoxy]benzamide (PubChem CID 51061653) has the molecular formula C32H28N4O3 and a molecular weight of 516.60 g/mol. Its IUPAC name is N-[(E)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-[(4-methylphenyl)methoxy]benzamide.
| Compound Name | N-[(E)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-[(4-methylphenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 51061653 |
| Molecular Formula | C32H28N4O3 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | N-[(E)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-[(4-methylphenyl)methoxy]benzamide |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2/C=N/NC(=O)c2ccc(OCc3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H28N4O3/c1-23-8-10-24(11-9-23)22-39-30-18-14-26(15-19-30)32(37)34-33-20-27-21-36(28-6-4-3-5-7-28)35-31(27)25-12-16-29(38-2)17-13-25/h3-21H,22H2,1-2H3,(H,34,37)/b33-20+ |
| InChIKey | BCYDHWSYIIDPQE-FMFFXOCNSA-N |
| XLogP | 6.20 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|