C24H19N5O4 — CID 34306104
N-[(Z)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-nitrobenzamide (PubChem CID 34306104) has the molecular formula C24H19N5O4 and a molecular weight of 441.45 g/mol. Its IUPAC name is N-[(Z)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-nitrobenzamide.
| Compound Name | N-[(Z)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 34306104 |
| Molecular Formula | C24H19N5O4 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | N-[(Z)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-nitrobenzamide |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2/C=N\NC(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C24H19N5O4/c1-33-22-13-9-17(10-14-22)23-19(16-28(27-23)20-5-3-2-4-6-20)15-25-26-24(30)18-7-11-21(12-8-18)29(31)32/h2-16H,1H3,(H,26,30)/b25-15- |
| InChIKey | XGCWVPMDLBOUAJ-MYYYXRDXSA-N |
| XLogP | 4.22 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|