C27H24BrN5O3 — CID 124632253
N-[(Z)-[3-(4-bromophenyl)-1-(4-nitrophenyl)pyrazol-4-yl]methylideneamino]-4-tert-butylbenzamide (PubChem CID 124632253) has the molecular formula C27H24BrN5O3 and a molecular weight of 546.43 g/mol. Its IUPAC name is N-[(Z)-[3-(4-bromophenyl)-1-(4-nitrophenyl)pyrazol-4-yl]methylideneamino]-4-tert-butylbenzamide.
| Compound Name | N-[(Z)-[3-(4-bromophenyl)-1-(4-nitrophenyl)pyrazol-4-yl]methylideneamino]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 124632253 |
| Molecular Formula | C27H24BrN5O3 |
| Molecular Weight | 546.43 g/mol |
| Exact Mass | 545.11 |
| IUPAC Name | N-[(Z)-[3-(4-bromophenyl)-1-(4-nitrophenyl)pyrazol-4-yl]methylideneamino]-4-tert-butylbenzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)N/N=C\c2cn(-c3ccc([N+](=O)[O-])cc3)nc2-c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C27H24BrN5O3/c1-27(2,3)21-8-4-19(5-9-21)26(34)30-29-16-20-17-32(23-12-14-24(15-13-23)33(35)36)31-25(20)18-6-10-22(28)11-7-18/h4-17H,1-3H3,(H,30,34)/b29-16- |
| InChIKey | XBMYOCKFMDXPNJ-MWLSYYOVSA-N |
| XLogP | 6.27 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.43 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|