C30H27N5O — CID 6024301
4-(2,5-dimethylpyrrol-1-yl)-N-[(Z)-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide (PubChem CID 6024301) has the molecular formula C30H27N5O and a molecular weight of 473.58 g/mol. Its IUPAC name is 4-(2,5-dimethylpyrrol-1-yl)-N-[(Z)-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide.
| Compound Name | 4-(2,5-dimethylpyrrol-1-yl)-N-[(Z)-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 6024301 |
| Molecular Formula | C30H27N5O |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 4-(2,5-dimethylpyrrol-1-yl)-N-[(Z)-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide |
| SMILES | Cc1ccc(-c2nn(-c3ccccc3)cc2/C=N\NC(=O)c2ccc(-n3c(C)ccc3C)cc2)cc1 |
| InChI | InChI=1S/C30H27N5O/c1-21-9-13-24(14-10-21)29-26(20-34(33-29)27-7-5-4-6-8-27)19-31-32-30(36)25-15-17-28(18-16-25)35-22(2)11-12-23(35)3/h4-20H,1-3H3,(H,32,36)/b31-19- |
| InChIKey | FUBZOESXLLVHNV-DXJNIWACSA-N |
| XLogP | 6.02 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|