C23H17FN4O2 — CID 9073073
N-[(Z)-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 9073073) has the molecular formula C23H17FN4O2 and a molecular weight of 400.41 g/mol. Its IUPAC name is N-[(Z)-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | N-[(Z)-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 9073073 |
| Molecular Formula | C23H17FN4O2 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | N-[(Z)-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | O=C(N/N=C\c1cn(-c2ccccc2)nc1-c1ccc(F)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C23H17FN4O2/c24-19-10-6-16(7-11-19)22-18(15-28(27-22)20-4-2-1-3-5-20)14-25-26-23(30)17-8-12-21(29)13-9-17/h1-15,29H,(H,26,30)/b25-14- |
| InChIKey | VALPXOYQKVPHLK-QFEZKATASA-N |
| XLogP | 4.15 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|