C32H31N5O2 — CID 6288798
4-(2,5-dimethylpyrrol-1-yl)-N-[(Z)-[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylideneamino]benzamide (PubChem CID 6288798) has the molecular formula C32H31N5O2 and a molecular weight of 517.63 g/mol. Its IUPAC name is 4-(2,5-dimethylpyrrol-1-yl)-N-[(Z)-[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylideneamino]benzamide.
| Compound Name | 4-(2,5-dimethylpyrrol-1-yl)-N-[(Z)-[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 6288798 |
| Molecular Formula | C32H31N5O2 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | 4-(2,5-dimethylpyrrol-1-yl)-N-[(Z)-[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylideneamino]benzamide |
| SMILES | CCCOc1ccc(-c2nn(-c3ccccc3)cc2/C=N\NC(=O)c2ccc(-n3c(C)ccc3C)cc2)cc1 |
| InChI | InChI=1S/C32H31N5O2/c1-4-20-39-30-18-14-25(15-19-30)31-27(22-36(35-31)28-8-6-5-7-9-28)21-33-34-32(38)26-12-16-29(17-13-26)37-23(2)10-11-24(37)3/h5-19,21-22H,4,20H2,1-3H3,(H,34,38)/b33-21- |
| InChIKey | RPIDFIKOKIXANY-HWIUFGAZSA-N |
| XLogP | 6.50 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|