C29H29N5O3 — CID 6271933
4-methyl-N-[2-oxo-2-[(2Z)-2-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylidene]hydrazinyl]ethyl]benzamide (PubChem CID 6271933) has the molecular formula C29H29N5O3 and a molecular weight of 495.58 g/mol. Its IUPAC name is 4-methyl-N-[2-oxo-2-[(2Z)-2-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylidene]hydrazinyl]ethyl]benzamide.
| Compound Name | 4-methyl-N-[2-oxo-2-[(2Z)-2-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylidene]hydrazinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 6271933 |
| Molecular Formula | C29H29N5O3 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 4-methyl-N-[2-oxo-2-[(2Z)-2-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylidene]hydrazinyl]ethyl]benzamide |
| SMILES | CCCOc1ccc(-c2nn(-c3ccccc3)cc2/C=N\NC(=O)CNC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C29H29N5O3/c1-3-17-37-26-15-13-22(14-16-26)28-24(20-34(33-28)25-7-5-4-6-8-25)18-31-32-27(35)19-30-29(36)23-11-9-21(2)10-12-23/h4-16,18,20H,3,17,19H2,1-2H3,(H,30,36)(H,32,35)/b31-18- |
| InChIKey | XZPOUVQGYGUOTA-MNBJERMJSA-N |
| XLogP | 4.52 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|