C29H30N4O3 — CID 4123323
2-(4-ethylphenoxy)-N-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylideneamino]acetamide (PubChem CID 4123323) has the molecular formula C29H30N4O3 and a molecular weight of 482.58 g/mol. Its IUPAC name is 2-(4-ethylphenoxy)-N-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylideneamino]acetamide.
| Compound Name | 2-(4-ethylphenoxy)-N-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 4123323 |
| Molecular Formula | C29H30N4O3 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 2-(4-ethylphenoxy)-N-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylideneamino]acetamide |
| SMILES | CCCOc1ccc(-c2nn(-c3ccccc3)cc2C=NNC(=O)COc2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C29H30N4O3/c1-3-18-35-26-16-12-23(13-17-26)29-24(20-33(32-29)25-8-6-5-7-9-25)19-30-31-28(34)21-36-27-14-10-22(4-2)11-15-27/h5-17,19-20H,3-4,18,21H2,1-2H3,(H,31,34) |
| InChIKey | YOQLBPMRRFMRCD-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|